About 6-azidoquinoxaline;hydrofluoride
6-azidoquinoxaline;hydrofluoride (PubChem CID 167560280) has the molecular formula C8H6FN5
and a molecular weight of 191.17 g/mol. Its IUPAC name is 6-azidoquinoxaline;hydrofluoride.
Molecular Properties
| Compound Name | 6-azidoquinoxaline;hydrofluoride |
| PubChem CID | 167560280 |
| Molecular Formula | C8H6FN5 |
| Molecular Weight | 191.17 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 6-azidoquinoxaline;hydrofluoride |
| SMILES | F.[N-]=[N+]=Nc1ccc2nccnc2c1 |
| InChI | InChI=1S/C8H5N5.FH/c9-13-12-6-1-2-7-8(5-6)11-4-3-10-7;/h1-5H;1H |
| InChIKey | DOJKSCDRCTXKEH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.17 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-azidoquinoxaline;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azidoquinoxaline;hydrofluoride?
The IUPAC name of 6-azidoquinoxaline;hydrofluoride (CID 167560280) is 6-azidoquinoxaline;hydrofluoride.
What is the SMILES notation for 6-azidoquinoxaline;hydrofluoride?
The canonical SMILES for 6-azidoquinoxaline;hydrofluoride is F.[N-]=[N+]=Nc1ccc2nccnc2c1.
What is the InChIKey of 6-azidoquinoxaline;hydrofluoride?
The InChIKey is DOJKSCDRCTXKEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N5.FH/c9-13-12-6-1-2-7-8(5-6)11-4-3-10-7;/h1-5H;1H.
What are the key properties of 6-azidoquinoxaline;hydrofluoride?
6-azidoquinoxaline;hydrofluoride has a molecular weight of 191.17 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azidoquinoxaline;hydrofluoride is sourced from PubChem (CID 167560280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).