C14H14N2O4 — CID 167564681
3-(3-methoxy-8-oxo-5H-1,5-naphthyridin-2-yl)pentane-2,4-dione (PubChem CID 167564681) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 3-(3-methoxy-8-oxo-5H-1,5-naphthyridin-2-yl)pentane-2,4-dione.
| Compound Name | 3-(3-methoxy-8-oxo-5H-1,5-naphthyridin-2-yl)pentane-2,4-dione |
|---|---|
| PubChem CID | 167564681 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-(3-methoxy-8-oxo-5H-1,5-naphthyridin-2-yl)pentane-2,4-dione |
| SMILES | COc1cc2[nH]ccc(=O)c2nc1C(C(C)=O)C(C)=O |
| InChI | InChI=1S/C14H14N2O4/c1-7(17)12(8(2)18)14-11(20-3)6-9-13(16-14)10(19)4-5-15-9/h4-6,12H,1-3H3,(H,15,19) |
| InChIKey | ZOKZOWPLWODIIZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|