C25H22FN3O4S — CID 167568650
4-cyclopropyl-3-[[4-fluoro-5-(2-methylpyrazol-3-yl)-2-pyrrol-1-ylphenyl]methylsulfonyl]benzoic acid (PubChem CID 167568650) has the molecular formula C25H22FN3O4S and a molecular weight of 479.53 g/mol. Its IUPAC name is 4-cyclopropyl-3-[[4-fluoro-5-(2-methylpyrazol-3-yl)-2-pyrrol-1-ylphenyl]methylsulfonyl]benzoic acid.
| Compound Name | 4-cyclopropyl-3-[[4-fluoro-5-(2-methylpyrazol-3-yl)-2-pyrrol-1-ylphenyl]methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 167568650 |
| Molecular Formula | C25H22FN3O4S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 4-cyclopropyl-3-[[4-fluoro-5-(2-methylpyrazol-3-yl)-2-pyrrol-1-ylphenyl]methylsulfonyl]benzoic acid |
| SMILES | Cn1nccc1-c1cc(CS(=O)(=O)c2cc(C(=O)O)ccc2C2CC2)c(-n2cccc2)cc1F |
| InChI | InChI=1S/C25H22FN3O4S/c1-28-22(8-9-27-28)20-12-18(23(14-21(20)26)29-10-2-3-11-29)15-34(32,33)24-13-17(25(30)31)6-7-19(24)16-4-5-16/h2-3,6-14,16H,4-5,15H2,1H3,(H,30,31) |
| InChIKey | XWWWRLFIYSXGFE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_G(4)', 'substructure': 'N/A'} |
|---|