C22H17FN2O4S — CID 167593517
3-[(5-cyano-4-fluoro-2-pyrrol-1-ylphenyl)methylsulfonyl]-4-cyclopropylbenzoic acid (PubChem CID 167593517) has the molecular formula C22H17FN2O4S and a molecular weight of 424.45 g/mol. Its IUPAC name is 3-[(5-cyano-4-fluoro-2-pyrrol-1-ylphenyl)methylsulfonyl]-4-cyclopropylbenzoic acid.
| Compound Name | 3-[(5-cyano-4-fluoro-2-pyrrol-1-ylphenyl)methylsulfonyl]-4-cyclopropylbenzoic acid |
|---|---|
| PubChem CID | 167593517 |
| Molecular Formula | C22H17FN2O4S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-[(5-cyano-4-fluoro-2-pyrrol-1-ylphenyl)methylsulfonyl]-4-cyclopropylbenzoic acid |
| SMILES | N#Cc1cc(CS(=O)(=O)c2cc(C(=O)O)ccc2C2CC2)c(-n2cccc2)cc1F |
| InChI | InChI=1S/C22H17FN2O4S/c23-19-11-20(25-7-1-2-8-25)17(9-16(19)12-24)13-30(28,29)21-10-15(22(26)27)5-6-18(21)14-3-4-14/h1-2,5-11,14H,3-4,13H2,(H,26,27) |
| InChIKey | ISRAAZYECVDQQT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |