C19H40N2O — CID 167569269
N-[2-[2-[4-(2,2-dimethylpropyl)piperidin-1-yl]ethoxy]ethyl]-2,2-dimethylpropan-1-amine (PubChem CID 167569269) has the molecular formula C19H40N2O and a molecular weight of 312.54 g/mol. Its IUPAC name is N-[2-[2-[4-(2,2-dimethylpropyl)piperidin-1-yl]ethoxy]ethyl]-2,2-dimethylpropan-1-amine.
| Compound Name | N-[2-[2-[4-(2,2-dimethylpropyl)piperidin-1-yl]ethoxy]ethyl]-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 167569269 |
| Molecular Formula | C19H40N2O |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.31 |
| IUPAC Name | N-[2-[2-[4-(2,2-dimethylpropyl)piperidin-1-yl]ethoxy]ethyl]-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)CNCCOCCN1CCC(CC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H40N2O/c1-18(2,3)15-17-7-10-21(11-8-17)12-14-22-13-9-20-16-19(4,5)6/h17,20H,7-16H2,1-6H3 |
| InChIKey | FRNYANHEKFJEFE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|