C25H33N7O — CID 167571376
1-amino-5-[4-[2-[(1-amino-3-methyliminoprop-1-en-2-yl)amino]pyrimidin-4-yl]-2-methylphenyl]-2-(tert-butyliminomethyl)pent-1-en-3-one (PubChem CID 167571376) has the molecular formula C25H33N7O and a molecular weight of 447.59 g/mol. Its IUPAC name is 1-amino-5-[4-[2-[(1-amino-3-methyliminoprop-1-en-2-yl)amino]pyrimidin-4-yl]-2-methylphenyl]-2-(tert-butyliminomethyl)pent-1-en-3-one.
| Compound Name | 1-amino-5-[4-[2-[(1-amino-3-methyliminoprop-1-en-2-yl)amino]pyrimidin-4-yl]-2-methylphenyl]-2-(tert-butyliminomethyl)pent-1-en-3-one |
|---|---|
| PubChem CID | 167571376 |
| Molecular Formula | C25H33N7O |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 1-amino-5-[4-[2-[(1-amino-3-methyliminoprop-1-en-2-yl)amino]pyrimidin-4-yl]-2-methylphenyl]-2-(tert-butyliminomethyl)pent-1-en-3-one |
| SMILES | C/N=C/C(=CN)Nc1nccc(-c2ccc(CCC(=O)C(=CN)/C=N/C(C)(C)C)c(C)c2)n1 |
| InChI | InChI=1S/C25H33N7O/c1-17-12-19(22-10-11-29-24(32-22)31-21(14-27)16-28-5)7-6-18(17)8-9-23(33)20(13-26)15-30-25(2,3)4/h6-7,10-16H,8-9,26-27H2,1-5H3,(H,29,31,32)/b20-13?,21-14?,28-16+,30-15+ |
| InChIKey | RXBFMZMIEWLUDP-QBUILVMJSA-N |
| XLogP | 3.58 |
| TPSA | 131.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|