C18H20N2O2 — CID 167572151
(3R)-2-benzyl-3-(furan-2-yl)-3,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-1-one (PubChem CID 167572151) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (3R)-2-benzyl-3-(furan-2-yl)-3,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-1-one.
| Compound Name | (3R)-2-benzyl-3-(furan-2-yl)-3,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-1-one |
|---|---|
| PubChem CID | 167572151 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (3R)-2-benzyl-3-(furan-2-yl)-3,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-1-one |
| SMILES | O=C1C2CCCCN2[C@@H](c2ccco2)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H20N2O2/c21-18-15-9-4-5-11-19(15)17(16-10-6-12-22-16)20(18)13-14-7-2-1-3-8-14/h1-3,6-8,10,12,15,17H,4-5,9,11,13H2/t15?,17-/m1/s1 |
| InChIKey | GAWSAVRTCQDKDV-OMOCHNIRSA-N |
| XLogP | 3.18 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |