C40H52N4O4 — CID 162196794
(4aS,5R,8aS)-1-benzyl-5-pyrrolidin-1-yl-4a,5,6,7,8,8a-hexahydro-4H-quinoline-2,3-dione;(4aR,5S,8aR)-1-benzyl-5-pyrrolidin-1-yl-4a,5,6,7,8,8a-hexahydro-4H-quinoline-2,3-dione (PubChem CID 162196794) has the molecular formula C40H52N4O4 and a molecular weight of 652.88 g/mol. Its IUPAC name is (4aS,5R,8aS)-1-benzyl-5-pyrrolidin-1-yl-4a,5,6,7,8,8a-hexahydro-4H-quinoline-2,3-dione;(4aR,5S,8aR)-1-benzyl-5-pyrrolidin-1-yl-4a,5,6,7,8,8a-hexahydro-4H-quinoline-2,3-dione.
| Compound Name | (4aS,5R,8aS)-1-benzyl-5-pyrrolidin-1-yl-4a,5,6,7,8,8a-hexahydro-4H-quinoline-2,3-dione;(4aR,5S,8aR)-1-benzyl-5-pyrrolidin-1-yl-4a,5,6,7,8,8a-hexahydro-4H-quinoline-2,3-dione |
|---|---|
| PubChem CID | 162196794 |
| Molecular Formula | C40H52N4O4 |
| Molecular Weight | 652.88 g/mol |
| Exact Mass | 652.40 |
| IUPAC Name | (4aS,5R,8aS)-1-benzyl-5-pyrrolidin-1-yl-4a,5,6,7,8,8a-hexahydro-4H-quinoline-2,3-dione;(4aR,5S,8aR)-1-benzyl-5-pyrrolidin-1-yl-4a,5,6,7,8,8a-hexahydro-4H-quinoline-2,3-dione |
| SMILES | O=C1C[C@H]2[C@@H](CCC[C@@H]2N2CCCC2)N(Cc2ccccc2)C1=O.O=C1C[C@H]2[C@H](N3CCCC3)CCC[C@@H]2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/2C20H26N2O2/c2*23-19-13-16-17(21-11-4-5-12-21)9-6-10-18(16)22(20(19)24)14-15-7-2-1-3-8-15/h2*1-3,7-8,16-18H,4-6,9-14H2/t2*16-,17+,18-/m10/s1 |
| InChIKey | ZRAWMSBWZVYDOB-ABAPOSMMSA-N |
| XLogP | 5.24 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.88 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|