C17H24N2S — CID 102070102
(4R,6R)-1-benzyl-6-methyl-4-pyrrolidin-1-ylpiperidine-2-thione (PubChem CID 102070102) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is (4R,6R)-1-benzyl-6-methyl-4-pyrrolidin-1-ylpiperidine-2-thione.
| Compound Name | (4R,6R)-1-benzyl-6-methyl-4-pyrrolidin-1-ylpiperidine-2-thione |
|---|---|
| PubChem CID | 102070102 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (4R,6R)-1-benzyl-6-methyl-4-pyrrolidin-1-ylpiperidine-2-thione |
| SMILES | C[C@@H]1C[C@@H](N2CCCC2)CC(=S)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H24N2S/c1-14-11-16(18-9-5-6-10-18)12-17(20)19(14)13-15-7-3-2-4-8-15/h2-4,7-8,14,16H,5-6,9-13H2,1H3/t14-,16-/m1/s1 |
| InChIKey | WJNJNLOYYSILCT-GDBMZVCRSA-N |
| XLogP | 3.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|