C40H52O10 — CID 167577946
1-ethenyl-2-(1-ethoxyethoxy)benzene;1-ethenyl-3-(1-ethoxyethoxy)benzene;[2-oxo-2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-1-yl)oxy]ethyl] 2-methylprop-2-enoate (PubChem CID 167577946) has the molecular formula C40H52O10 and a molecular weight of 692.85 g/mol. Its IUPAC name is 1-ethenyl-2-(1-ethoxyethoxy)benzene;1-ethenyl-3-(1-ethoxyethoxy)benzene;[2-oxo-2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-1-yl)oxy]ethyl] 2-methylprop-2-enoate.
| Compound Name | 1-ethenyl-2-(1-ethoxyethoxy)benzene;1-ethenyl-3-(1-ethoxyethoxy)benzene;[2-oxo-2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-1-yl)oxy]ethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 167577946 |
| Molecular Formula | C40H52O10 |
| Molecular Weight | 692.85 g/mol |
| Exact Mass | 692.36 |
| IUPAC Name | 1-ethenyl-2-(1-ethoxyethoxy)benzene;1-ethenyl-3-(1-ethoxyethoxy)benzene;[2-oxo-2-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-1-yl)oxy]ethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC12CC3CC(C1)OC(=O)C(C3)C2.C=Cc1cccc(OC(C)OCC)c1.C=Cc1ccccc1OC(C)OCC |
| InChI | InChI=1S/C16H20O6.2C12H16O2/c1-9(2)14(18)20-8-13(17)22-16-5-10-3-11(6-16)15(19)21-12(4-10)7-16;1-4-11-7-6-8-12(9-11)14-10(3)13-5-2;1-4-11-8-6-7-9-12(11)14-10(3)13-5-2/h10-12H,1,3-8H2,2H3;2*4,6-10H,1,5H2,2-3H3 |
| InChIKey | GUBVTFORARAIRR-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.85 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|