C18H25BrO6 — CID 88899775
(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-1-yl) 2-(2-bromobutanoyloxy)butanoate (PubChem CID 88899775) has the molecular formula C18H25BrO6 and a molecular weight of 417.30 g/mol. Its IUPAC name is (5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-1-yl) 2-(2-bromobutanoyloxy)butanoate.
| Compound Name | (5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-1-yl) 2-(2-bromobutanoyloxy)butanoate |
|---|---|
| PubChem CID | 88899775 |
| Molecular Formula | C18H25BrO6 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-1-yl) 2-(2-bromobutanoyloxy)butanoate |
| SMILES | CCC(Br)C(=O)OC(CC)C(=O)OC12CC3CC(C1)OC(=O)C(C3)C2 |
| InChI | InChI=1S/C18H25BrO6/c1-3-13(19)16(21)24-14(4-2)17(22)25-18-7-10-5-11(8-18)15(20)23-12(6-10)9-18/h10-14H,3-9H2,1-2H3 |
| InChIKey | DAZJLAVXVANJFZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|