About 1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate
1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate (PubChem CID 23531623) has the molecular formula C29H42O5
and a molecular weight of 470.65 g/mol. Its IUPAC name is 1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate.
Molecular Properties
| Compound Name | 1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate |
| PubChem CID | 23531623 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | 1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate |
| SMILES | CCC(CC(C)C(=O)OC12CC3CC(CC(C3)C1C)C2)C(=O)OC12CC3CC(C1)C(=O)C(C3)C2 |
| InChI | InChI=1S/C29H42O5/c1-4-21(27(32)33-28-11-20-9-23(14-28)25(30)24(10-20)15-28)5-16(2)26(31)34-29-12-18-6-19(13-29)8-22(7-18)17(29)3/h16-24H,4-15H2,1-3H3 |
| InChIKey | DPTYCCWJUIYYEB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate?
The IUPAC name of 1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate (CID 23531623) is 1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate.
What is the SMILES notation for 1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate?
The canonical SMILES for 1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate is CCC(CC(C)C(=O)OC12CC3CC(CC(C3)C1C)C2)C(=O)OC12CC3CC(C1)C(=O)C(C3)C2.
What is the InChIKey of 1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate?
The InChIKey is DPTYCCWJUIYYEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H42O5/c1-4-21(27(32)33-28-11-20-9-23(14-28)25(30)24(10-20)15-28)5-16(2)26(31)34-29-12-18-6-19(13-29)8-22(7-18)17(29)3/h16-24H,4-15H2,1-3H3.
What are the key properties of 1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate?
1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate has a molecular weight of 470.65 g/mol, XLogP of 5.49, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2-methyl-1-adamantyl) 5-O-(4-oxo-1-adamantyl) 4-ethyl-2-methylpentanedioate is sourced from PubChem (CID 23531623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).