C21H32O7 — CID 16758331
(1R,8R,9S,14Z,16R,17S,20S)-20-hydroxy-9-methoxy-8,16-dimethyl-3,11,21-trioxabicyclo[15.3.1]henicosa-14,18-diene-4,12-dione (PubChem CID 16758331) has the molecular formula C21H32O7 and a molecular weight of 396.48 g/mol. Its IUPAC name is (1R,8R,9S,14Z,16R,17S,20S)-20-hydroxy-9-methoxy-8,16-dimethyl-3,11,21-trioxabicyclo[15.3.1]henicosa-14,18-diene-4,12-dione.
| Compound Name | (1R,8R,9S,14Z,16R,17S,20S)-20-hydroxy-9-methoxy-8,16-dimethyl-3,11,21-trioxabicyclo[15.3.1]henicosa-14,18-diene-4,12-dione |
|---|---|
| PubChem CID | 16758331 |
| Molecular Formula | C21H32O7 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | (1R,8R,9S,14Z,16R,17S,20S)-20-hydroxy-9-methoxy-8,16-dimethyl-3,11,21-trioxabicyclo[15.3.1]henicosa-14,18-diene-4,12-dione |
| SMILES | CO[C@@H]1COC(=O)C/C=C\[C@@H](C)[C@@H]2C=C[C@H](O)[C@@H](COC(=O)CCC[C@H]1C)O2 |
| InChI | InChI=1S/C21H32O7/c1-14-6-4-8-20(23)26-12-18(25-3)15(2)7-5-9-21(24)27-13-19-16(22)10-11-17(14)28-19/h4,6,10-11,14-19,22H,5,7-9,12-13H2,1-3H3/b6-4-/t14-,15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | ZPFUQBPYNIZRGQ-ZJBKBCAPSA-N |
| XLogP | 2.17 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|