C55H35NO2 — CID 167584125
2,3,5,6-tetradeuterio-4-dibenzofuran-1-yl-N-(4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(9H-fluoren-4-yl)phenyl]aniline (PubChem CID 167584125) has the molecular formula C55H35NO2 and a molecular weight of 749.94 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-dibenzofuran-1-yl-N-(4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(9H-fluoren-4-yl)phenyl]aniline.
| Compound Name | 2,3,5,6-tetradeuterio-4-dibenzofuran-1-yl-N-(4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(9H-fluoren-4-yl)phenyl]aniline |
|---|---|
| PubChem CID | 167584125 |
| Molecular Formula | C55H35NO2 |
| Molecular Weight | 749.94 g/mol |
| Exact Mass | 749.32 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-dibenzofuran-1-yl-N-(4-dibenzofuran-4-ylphenyl)-N-[2,3,5,6-tetradeuterio-4-(9H-fluoren-4-yl)phenyl]aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3cccc4c3oc3ccccc34)cc2)c2c([2H])c([2H])c(-c3cccc4oc5ccccc5c34)c([2H])c2[2H])c([2H])c([2H])c1-c1cccc2c1-c1ccccc1C2 |
| InChI | InChI=1S/C55H35NO2/c1-2-12-45-38(10-1)34-39-11-7-15-43(53(39)45)35-22-28-40(29-23-35)56(41-30-24-36(25-31-41)44-16-9-21-52-54(44)49-14-4-6-20-51(49)57-52)42-32-26-37(27-33-42)46-17-8-18-48-47-13-3-5-19-50(47)58-55(46)48/h1-33H,34H2/i22D,23D,24D,25D,28D,29D,30D,31D |
| InChIKey | UDMJGCLEHYIQKR-MCEPZVRCSA-N |
| XLogP | 15.53 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.94 |
| LogP ≤ 5 | 15.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |