C17H20N4O3 — CID 167584463
2-(1-ethyl-6,6-dimethyl-4,5-dihydropyrrolo[3,4-c]pyrazol-3-yl)-1-(4-nitrophenyl)ethanone (PubChem CID 167584463) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-(1-ethyl-6,6-dimethyl-4,5-dihydropyrrolo[3,4-c]pyrazol-3-yl)-1-(4-nitrophenyl)ethanone.
| Compound Name | 2-(1-ethyl-6,6-dimethyl-4,5-dihydropyrrolo[3,4-c]pyrazol-3-yl)-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 167584463 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-(1-ethyl-6,6-dimethyl-4,5-dihydropyrrolo[3,4-c]pyrazol-3-yl)-1-(4-nitrophenyl)ethanone |
| SMILES | CCn1nc(CC(=O)c2ccc([N+](=O)[O-])cc2)c2c1C(C)(C)NC2 |
| InChI | InChI=1S/C17H20N4O3/c1-4-20-16-13(10-18-17(16,2)3)14(19-20)9-15(22)11-5-7-12(8-6-11)21(23)24/h5-8,18H,4,9-10H2,1-3H3 |
| InChIKey | HPIKLUHZRJQDEX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|