C15H15N5O5 — CID 175183349
6,6-dimethyl-3-[(4-nitrobenzoyl)amino]-4,5-dihydropyrrolo[3,4-d]pyrazole-1-carboxylic acid (PubChem CID 175183349) has the molecular formula C15H15N5O5 and a molecular weight of 345.32 g/mol. Its IUPAC name is 6,6-dimethyl-3-[(4-nitrobenzoyl)amino]-4,5-dihydropyrrolo[3,4-d]pyrazole-1-carboxylic acid.
| Compound Name | 6,6-dimethyl-3-[(4-nitrobenzoyl)amino]-4,5-dihydropyrrolo[3,4-d]pyrazole-1-carboxylic acid |
|---|---|
| PubChem CID | 175183349 |
| Molecular Formula | C15H15N5O5 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 6,6-dimethyl-3-[(4-nitrobenzoyl)amino]-4,5-dihydropyrrolo[3,4-d]pyrazole-1-carboxylic acid |
| SMILES | CC1(C)NCc2c(NC(=O)c3ccc([N+](=O)[O-])cc3)nn(C(=O)O)c21 |
| InChI | InChI=1S/C15H15N5O5/c1-15(2)11-10(7-16-15)12(18-19(11)14(22)23)17-13(21)8-3-5-9(6-4-8)20(24)25/h3-6,16H,7H2,1-2H3,(H,22,23)(H,17,18,21) |
| InChIKey | NFLPIKBZAWOOEU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|