C20H23N5O3S2 — CID 167586404
trans-(1R,2R)-N-[5-[5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]thiophen-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-methylcyclopropane-1-carboxamide (PubChem CID 167586404) has the molecular formula C20H23N5O3S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is trans-(1R,2R)-N-[5-[5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]thiophen-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[5-[5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]thiophen-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 167586404 |
| Molecular Formula | C20H23N5O3S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | trans-(1R,2R)-N-[5-[5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]thiophen-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-methylcyclopropane-1-carboxamide |
| SMILES | C[C@@H]1C[C@H]1C(=O)Nc1nc2cccc(-c3ccc(CN4CCS(=O)(=O)CC4)s3)n2n1 |
| InChI | InChI=1S/C20H23N5O3S2/c1-13-11-15(13)19(26)22-20-21-18-4-2-3-16(25(18)23-20)17-6-5-14(29-17)12-24-7-9-30(27,28)10-8-24/h2-6,13,15H,7-12H2,1H3,(H,22,23,26)/t13-,15-/m1/s1 |
| InChIKey | HXDYSHIJNTZJNU-UKRRQHHQSA-N |
| XLogP | 2.28 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |