C21H25N5O3S+2 — CID 117072110
N-[5-[4-[(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)methyl]phenyl]-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-2-yl]cyclopropanecarboxamide (PubChem CID 117072110) has the molecular formula C21H25N5O3S+2 and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[5-[4-[(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)methyl]phenyl]-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-[4-[(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)methyl]phenyl]-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 117072110 |
| Molecular Formula | C21H25N5O3S+2 |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[5-[4-[(1,1-dioxo-1,4-thiazinan-4-ium-4-yl)methyl]phenyl]-3H-[1,2,4]triazolo[1,5-a]pyridin-4-ium-2-yl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1nc2cccc(-c3ccc(C[NH+]4CCS(=O)(=O)CC4)cc3)[n+]2[nH]1)C1CC1 |
| InChI | InChI=1S/C21H23N5O3S/c27-20(17-8-9-17)23-21-22-19-3-1-2-18(26(19)24-21)16-6-4-15(5-7-16)14-25-10-12-30(28,29)13-11-25/h1-7,17H,8-14H2,(H,23,24,27)/p+2 |
| InChIKey | RIJLVEAXPNLDTC-UHFFFAOYSA-P |
| XLogP | -0.02 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|