C13H14F3N2O5P — CID 167587497
ethoxy-(2-methylcinnolin-2-ium-4-yl)phosphinic acid;2,2,2-trifluoroacetate (PubChem CID 167587497) has the molecular formula C13H14F3N2O5P and a molecular weight of 366.23 g/mol. Its IUPAC name is ethoxy-(2-methylcinnolin-2-ium-4-yl)phosphinic acid;2,2,2-trifluoroacetate.
| Compound Name | ethoxy-(2-methylcinnolin-2-ium-4-yl)phosphinic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 167587497 |
| Molecular Formula | C13H14F3N2O5P |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | ethoxy-(2-methylcinnolin-2-ium-4-yl)phosphinic acid;2,2,2-trifluoroacetate |
| SMILES | CCOP(=O)(O)c1c[n+](C)nc2ccccc12.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C11H13N2O3P.C2HF3O2/c1-3-16-17(14,15)11-8-13(2)12-10-7-5-4-6-9(10)11;3-2(4,5)1(6)7/h4-8H,3H2,1-2H3;(H,6,7) |
| InChIKey | YXJNPWSFVWWBHC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|