C35H49NO6 — CID 167588741
[(1R,2S,6R,10S,11R,13S,15R)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2S)-2-amino-8-(4-methylphenyl)octanoate (PubChem CID 167588741) has the molecular formula C35H49NO6 and a molecular weight of 579.78 g/mol. Its IUPAC name is [(1R,2S,6R,10S,11R,13S,15R)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2S)-2-amino-8-(4-methylphenyl)octanoate.
| Compound Name | [(1R,2S,6R,10S,11R,13S,15R)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2S)-2-amino-8-(4-methylphenyl)octanoate |
|---|---|
| PubChem CID | 167588741 |
| Molecular Formula | C35H49NO6 |
| Molecular Weight | 579.78 g/mol |
| Exact Mass | 579.36 |
| IUPAC Name | [(1R,2S,6R,10S,11R,13S,15R)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] (2S)-2-amino-8-(4-methylphenyl)octanoate |
| SMILES | CC1=C[C@H]2[C@@]3(O)[C@H](C)C[C@]4(OC(=O)[C@@H](N)CCCCCCc5ccc(C)cc5)[C@H]([C@@H]3C=C(CO)C[C@]2(O)C1=O)C4(C)C |
| InChI | InChI=1S/C35H49NO6/c1-21-12-14-24(15-13-21)10-8-6-7-9-11-27(36)31(39)42-34-18-23(3)35(41)26(29(34)32(34,4)5)17-25(20-37)19-33(40)28(35)16-22(2)30(33)38/h12-17,23,26-29,37,40-41H,6-11,18-20,36H2,1-5H3/t23-,26+,27+,28-,29-,33-,34+,35-/m1/s1 |
| InChIKey | IDLUAIBQPDDJGB-OPLJRGGPSA-N |
| XLogP | 4.34 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.78 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|