C7H11FN2 — CID 167589330
1-(1-fluoroethyl)-4,5-dimethylpyrazole (PubChem CID 167589330) has the molecular formula C7H11FN2 and a molecular weight of 142.18 g/mol. Its IUPAC name is 1-(1-fluoroethyl)-4,5-dimethylpyrazole.
| Compound Name | 1-(1-fluoroethyl)-4,5-dimethylpyrazole |
|---|---|
| PubChem CID | 167589330 |
| Molecular Formula | C7H11FN2 |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 1-(1-fluoroethyl)-4,5-dimethylpyrazole |
| SMILES | Cc1cnn(C(C)F)c1C |
| InChI | InChI=1S/C7H11FN2/c1-5-4-9-10(6(5)2)7(3)8/h4,7H,1-3H3 |
| InChIKey | BWKHMIULVSIDTI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |