C6H8F3N3 — CID 175533893
5-methyl-1-(1,2,2-trifluoroethyl)pyrazol-4-amine (PubChem CID 175533893) has the molecular formula C6H8F3N3 and a molecular weight of 179.15 g/mol. Its IUPAC name is 5-methyl-1-(1,2,2-trifluoroethyl)pyrazol-4-amine.
| Compound Name | 5-methyl-1-(1,2,2-trifluoroethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 175533893 |
| Molecular Formula | C6H8F3N3 |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 5-methyl-1-(1,2,2-trifluoroethyl)pyrazol-4-amine |
| SMILES | Cc1c(N)cnn1C(F)C(F)F |
| InChI | InChI=1S/C6H8F3N3/c1-3-4(10)2-11-12(3)6(9)5(7)8/h2,5-6H,10H2,1H3 |
| InChIKey | BJAUIVJJRWGFKK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |