About 3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene
3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene (PubChem CID 167590032) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene.
Molecular Properties
| Compound Name | 3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene |
| PubChem CID | 167590032 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene |
| SMILES | CC(C)C1=NC2=C(CC2)C1 |
| InChI | InChI=1S/C9H13N/c1-6(2)9-5-7-3-4-8(7)10-9/h6H,3-5H2,1-2H3 |
| InChIKey | VKKGVBMJYIHVNI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene?
The IUPAC name of 3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene (CID 167590032) is 3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene.
What is the SMILES notation for 3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene?
The canonical SMILES for 3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene is CC(C)C1=NC2=C(CC2)C1.
What is the InChIKey of 3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene?
The InChIKey is VKKGVBMJYIHVNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-6(2)9-5-7-3-4-8(7)10-9/h6H,3-5H2,1-2H3.
What are the key properties of 3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene?
3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene has a molecular weight of 135.21 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-2-azabicyclo[3.2.0]hepta-1(5),2-diene is sourced from PubChem (CID 167590032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).