C8H14N2 — CID 146204571
2-methyl-6-propan-2-yl-4,5-dihydropyrimidine (PubChem CID 146204571) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-methyl-6-propan-2-yl-4,5-dihydropyrimidine.
| Compound Name | 2-methyl-6-propan-2-yl-4,5-dihydropyrimidine |
|---|---|
| PubChem CID | 146204571 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2-methyl-6-propan-2-yl-4,5-dihydropyrimidine |
| SMILES | CC1=NCCC(C(C)C)=N1 |
| InChI | InChI=1S/C8H14N2/c1-6(2)8-4-5-9-7(3)10-8/h6H,4-5H2,1-3H3 |
| InChIKey | IRXRDLRUBUEXCD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |