About 4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine
4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine (PubChem CID 167593442) has the molecular formula C14H18F2N2O
and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine.
Molecular Properties
| Compound Name | 4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine |
| PubChem CID | 167593442 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine |
| SMILES | COc1cnc(C)nc1/C=C/C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H18F2N2O/c1-10-17-9-13(19-2)12(18-10)4-3-11-5-7-14(15,16)8-6-11/h3-4,9,11H,5-8H2,1-2H3/b4-3+ |
| InChIKey | ISJCHICITIFEIA-ONEGZZNKSA-N |
| XLogP | 3.63 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine?
The IUPAC name of 4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine (CID 167593442) is 4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine.
What is the SMILES notation for 4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine?
The canonical SMILES for 4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine is COc1cnc(C)nc1/C=C/C1CCC(F)(F)CC1.
What is the InChIKey of 4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine?
The InChIKey is ISJCHICITIFEIA-ONEGZZNKSA-N. The full InChI is InChI=1S/C14H18F2N2O/c1-10-17-9-13(19-2)12(18-10)4-3-11-5-7-14(15,16)8-6-11/h3-4,9,11H,5-8H2,1-2H3/b4-3+.
What are the key properties of 4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine?
4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine has a molecular weight of 268.31 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(4,4-difluorocyclohexyl)ethenyl]-5-methoxy-2-methylpyrimidine is sourced from PubChem (CID 167593442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).