C36H35FN6O3S2 — CID 167598501
2-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-hex-5-ynylamino]-5-[3-(2-fluoro-4-pent-1-ynylphenoxy)propyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 167598501) has the molecular formula C36H35FN6O3S2 and a molecular weight of 682.85 g/mol. Its IUPAC name is 2-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-hex-5-ynylamino]-5-[3-(2-fluoro-4-pent-1-ynylphenoxy)propyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-hex-5-ynylamino]-5-[3-(2-fluoro-4-pent-1-ynylphenoxy)propyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 167598501 |
| Molecular Formula | C36H35FN6O3S2 |
| Molecular Weight | 682.85 g/mol |
| Exact Mass | 682.22 |
| IUPAC Name | 2-[[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]-hex-5-ynylamino]-5-[3-(2-fluoro-4-pent-1-ynylphenoxy)propyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | C#CCCCCN(c1cc(C)c(Nc2nc3ccccc3s2)nn1)c1nc(C(=O)O)c(CCCOc2ccc(C#CCCC)cc2F)s1 |
| InChI | InChI=1S/C36H35FN6O3S2/c1-4-6-8-12-20-43(31-22-24(3)33(42-41-31)40-35-38-27-15-10-11-16-29(27)47-35)36-39-32(34(44)45)30(48-36)17-13-21-46-28-19-18-25(23-26(28)37)14-9-7-5-2/h1,10-11,15-16,18-19,22-23H,5-8,12-13,17,20-21H2,2-3H3,(H,44,45)(H,38,40,42) |
| InChIKey | JKBWZCXXJBDKMA-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 113.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.85 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|