C35H38FN7O3S2 — CID 167647160
2-[5-aminopentyl-[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]amino]-5-[3-(2-fluoro-4-pent-1-ynylphenoxy)propyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 167647160) has the molecular formula C35H38FN7O3S2 and a molecular weight of 687.87 g/mol. Its IUPAC name is 2-[5-aminopentyl-[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]amino]-5-[3-(2-fluoro-4-pent-1-ynylphenoxy)propyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[5-aminopentyl-[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]amino]-5-[3-(2-fluoro-4-pent-1-ynylphenoxy)propyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 167647160 |
| Molecular Formula | C35H38FN7O3S2 |
| Molecular Weight | 687.87 g/mol |
| Exact Mass | 687.25 |
| IUPAC Name | 2-[5-aminopentyl-[6-(1,3-benzothiazol-2-ylamino)-5-methylpyridazin-3-yl]amino]-5-[3-(2-fluoro-4-pent-1-ynylphenoxy)propyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCC#Cc1ccc(OCCCc2sc(N(CCCCCN)c3cc(C)c(Nc4nc5ccccc5s4)nn3)nc2C(=O)O)c(F)c1 |
| InChI | InChI=1S/C35H38FN7O3S2/c1-3-4-6-12-24-16-17-27(25(36)22-24)46-20-11-15-29-31(33(44)45)39-35(48-29)43(19-10-5-9-18-37)30-21-23(2)32(42-41-30)40-34-38-26-13-7-8-14-28(26)47-34/h7-8,13-14,16-17,21-22H,3-5,9-11,15,18-20,37H2,1-2H3,(H,44,45)(H,38,40,42) |
| InChIKey | QAVFKEMKEDMPFH-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.87 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|