C30H35N3O4 — CID 167598579
5-hydroxy-6-[3-(2-methoxyethylamino)-2-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]propyl]-3H-pyridin-4-one (PubChem CID 167598579) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is 5-hydroxy-6-[3-(2-methoxyethylamino)-2-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]propyl]-3H-pyridin-4-one.
| Compound Name | 5-hydroxy-6-[3-(2-methoxyethylamino)-2-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]propyl]-3H-pyridin-4-one |
|---|---|
| PubChem CID | 167598579 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 5-hydroxy-6-[3-(2-methoxyethylamino)-2-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]propyl]-3H-pyridin-4-one |
| SMILES | COCCNCC(CC1=C(O)C(=O)CC=N1)c1ccc(C#Cc2ccc(CN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C30H35N3O4/c1-36-17-14-31-21-27(20-28-30(35)29(34)12-13-32-28)26-10-8-24(9-11-26)3-2-23-4-6-25(7-5-23)22-33-15-18-37-19-16-33/h4-11,13,27,31,35H,12,14-22H2,1H3 |
| InChIKey | UEJOTGITMYIVEC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|