C12H9FO4S — CID 167600017
4-(benzenesulfonylmethyl)-5-fluorocyclopent-4-ene-1,3-dione (PubChem CID 167600017) has the molecular formula C12H9FO4S and a molecular weight of 268.26 g/mol. Its IUPAC name is 4-(benzenesulfonylmethyl)-5-fluorocyclopent-4-ene-1,3-dione.
| Compound Name | 4-(benzenesulfonylmethyl)-5-fluorocyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 167600017 |
| Molecular Formula | C12H9FO4S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 4-(benzenesulfonylmethyl)-5-fluorocyclopent-4-ene-1,3-dione |
| SMILES | O=C1CC(=O)C(CS(=O)(=O)c2ccccc2)=C1F |
| InChI | InChI=1S/C12H9FO4S/c13-12-9(10(14)6-11(12)15)7-18(16,17)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | MDCLWNVITLVKRX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|