C29H34N4O2 — CID 167602326
(5aS,6S,9aR)-6-benzyl-2,9a-dimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile;N-methylhydroxylamine;tritiomethane (PubChem CID 167602326) has the molecular formula C29H34N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is (5aS,6S,9aR)-6-benzyl-2,9a-dimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile;N-methylhydroxylamine;tritiomethane.
| Compound Name | (5aS,6S,9aR)-6-benzyl-2,9a-dimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile;N-methylhydroxylamine;tritiomethane |
|---|---|
| PubChem CID | 167602326 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | (5aS,6S,9aR)-6-benzyl-2,9a-dimethyl-7-oxo-3-phenyl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile;N-methylhydroxylamine;tritiomethane |
| SMILES | CNO.Cn1nc2c(c1-c1ccccc1)CC[C@H]1[C@H](Cc3ccccc3)C(=O)C(C#N)=C[C@]21C.[3H]C |
| InChI | InChI=1S/C27H25N3O.CH5NO.CH4/c1-27-16-20(17-28)25(31)22(15-18-9-5-3-6-10-18)23(27)14-13-21-24(30(2)29-26(21)27)19-11-7-4-8-12-19;1-2-3;/h3-12,16,22-23H,13-15H2,1-2H3;2-3H,1H3;1H4/t22-,23-,27-;;/m0../s1/i;;1T |
| InChIKey | JXHOMQSADCSGSQ-XMUPFRDKSA-N |
| XLogP | 5.03 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|