C22H19ClN2O2 — CID 167602608
6-chloro-N-[4-(2-oxo-4-phenylbutyl)phenyl]pyridine-2-carboxamide (PubChem CID 167602608) has the molecular formula C22H19ClN2O2 and a molecular weight of 378.86 g/mol. Its IUPAC name is 6-chloro-N-[4-(2-oxo-4-phenylbutyl)phenyl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[4-(2-oxo-4-phenylbutyl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167602608 |
| Molecular Formula | C22H19ClN2O2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 6-chloro-N-[4-(2-oxo-4-phenylbutyl)phenyl]pyridine-2-carboxamide |
| SMILES | O=C(CCc1ccccc1)Cc1ccc(NC(=O)c2cccc(Cl)n2)cc1 |
| InChI | InChI=1S/C22H19ClN2O2/c23-21-8-4-7-20(25-21)22(27)24-18-12-9-17(10-13-18)15-19(26)14-11-16-5-2-1-3-6-16/h1-10,12-13H,11,14-15H2,(H,24,27) |
| InChIKey | XTDGVJTWPHHKEB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|