C11H19N3O4S — CID 167602737
N-[2-(1,3-dioxo-2,8-diazaspiro[4.5]decan-2-yl)ethyl]methanesulfonamide (PubChem CID 167602737) has the molecular formula C11H19N3O4S and a molecular weight of 289.36 g/mol. Its IUPAC name is N-[2-(1,3-dioxo-2,8-diazaspiro[4.5]decan-2-yl)ethyl]methanesulfonamide.
| Compound Name | N-[2-(1,3-dioxo-2,8-diazaspiro[4.5]decan-2-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 167602737 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-[2-(1,3-dioxo-2,8-diazaspiro[4.5]decan-2-yl)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN1C(=O)CC2(CCNCC2)C1=O |
| InChI | InChI=1S/C11H19N3O4S/c1-19(17,18)13-6-7-14-9(15)8-11(10(14)16)2-4-12-5-3-11/h12-13H,2-8H2,1H3 |
| InChIKey | RERYAVQKYTWXSJ-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|