C18H24N2O4S — CID 132972173
N-benzyl-N-[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)ethyl]methanesulfonamide (PubChem CID 132972173) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-benzyl-N-[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)ethyl]methanesulfonamide.
| Compound Name | N-benzyl-N-[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 132972173 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-benzyl-N-[2-(1,3-dioxo-2-azaspiro[4.4]nonan-2-yl)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(CCN1C(=O)CC2(CCCC2)C1=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H24N2O4S/c1-25(23,24)19(14-15-7-3-2-4-8-15)11-12-20-16(21)13-18(17(20)22)9-5-6-10-18/h2-4,7-8H,5-6,9-14H2,1H3 |
| InChIKey | ZENJPFWDTILQJN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|