C19H25N3O4S — CID 9243588
2-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 9243588) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is 2-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | 2-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 9243588 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-[[4-(benzenesulfonyl)piperazin-1-yl]methyl]-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | O=C1CC2(CCCC2)C(=O)N1CN1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H25N3O4S/c23-17-14-19(8-4-5-9-19)18(24)22(17)15-20-10-12-21(13-11-20)27(25,26)16-6-2-1-3-7-16/h1-3,6-7H,4-5,8-15H2 |
| InChIKey | CMLKQHSAJKDLKA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|