C16H15N9O6 — CID 167603608
2-[[5-[(2-amino-4-oxo-3H-pteridin-6-yl)methylideneamino]-1H-imidazole-2-carbonyl]amino]pentanedioic acid (PubChem CID 167603608) has the molecular formula C16H15N9O6 and a molecular weight of 429.35 g/mol. Its IUPAC name is 2-[[5-[(2-amino-4-oxo-3H-pteridin-6-yl)methylideneamino]-1H-imidazole-2-carbonyl]amino]pentanedioic acid.
| Compound Name | 2-[[5-[(2-amino-4-oxo-3H-pteridin-6-yl)methylideneamino]-1H-imidazole-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 167603608 |
| Molecular Formula | C16H15N9O6 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 2-[[5-[(2-amino-4-oxo-3H-pteridin-6-yl)methylideneamino]-1H-imidazole-2-carbonyl]amino]pentanedioic acid |
| SMILES | Nc1nc2ncc(C=Nc3cnc(C(=O)NC(CCC(=O)O)C(=O)O)[nH]3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H15N9O6/c17-16-24-11-10(13(28)25-16)21-6(4-19-11)3-18-8-5-20-12(23-8)14(29)22-7(15(30)31)1-2-9(26)27/h3-5,7H,1-2H2,(H,20,23)(H,22,29)(H,26,27)(H,30,31)(H3,17,19,24,25,28) |
| InChIKey | KBSMYUGEELGGES-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 242.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|