About 7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine
7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine (PubChem CID 167604448) has the molecular formula C19H23FN4O2
and a molecular weight of 358.42 g/mol. Its IUPAC name is 7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine.
Molecular Properties
| Compound Name | 7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine |
| PubChem CID | 167604448 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine |
| SMILES | CCCC(C)(C)N.O=C(O)c1ccc(F)c2nn(-c3cccnc3)cc12 |
| InChI | InChI=1S/C13H8FN3O2.C6H15N/c14-11-4-3-9(13(18)19)10-7-17(16-12(10)11)8-2-1-5-15-6-8;1-4-5-6(2,3)7/h1-7H,(H,18,19);4-5,7H2,1-3H3 |
| InChIKey | KENGXCBPHFQYBX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine?
The IUPAC name of 7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine (CID 167604448) is 7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine.
What is the SMILES notation for 7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine?
The canonical SMILES for 7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine is CCCC(C)(C)N.O=C(O)c1ccc(F)c2nn(-c3cccnc3)cc12.
What is the InChIKey of 7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine?
The InChIKey is KENGXCBPHFQYBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8FN3O2.C6H15N/c14-11-4-3-9(13(18)19)10-7-17(16-12(10)11)8-2-1-5-15-6-8;1-4-5-6(2,3)7/h1-7H,(H,18,19);4-5,7H2,1-3H3.
What are the key properties of 7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine?
7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine has a molecular weight of 358.42 g/mol, XLogP of 3.78, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2-pyridin-3-ylindazole-4-carboxylic acid;2-methylpentan-2-amine is sourced from PubChem (CID 167604448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).