C17H22ClN5O3 — CID 118023775
[3-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-3-oxopropyl]-propylcarbamic acid (PubChem CID 118023775) has the molecular formula C17H22ClN5O3 and a molecular weight of 379.85 g/mol. Its IUPAC name is [3-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-3-oxopropyl]-propylcarbamic acid.
| Compound Name | [3-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-3-oxopropyl]-propylcarbamic acid |
|---|---|
| PubChem CID | 118023775 |
| Molecular Formula | C17H22ClN5O3 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [3-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-3-oxopropyl]-propylcarbamic acid |
| SMILES | CCCN(CCC(=O)N(CC)c1cn(-c2cccnc2)nc1Cl)C(=O)O |
| InChI | InChI=1S/C17H22ClN5O3/c1-3-9-21(17(25)26)10-7-15(24)22(4-2)14-12-23(20-16(14)18)13-6-5-8-19-11-13/h5-6,8,11-12H,3-4,7,9-10H2,1-2H3,(H,25,26) |
| InChIKey | DPHGZGICNYVOPD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |