C17H18ClF3N4O2 — CID 118023098
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-7,7,7-trifluoro-3-oxoheptanamide (PubChem CID 118023098) has the molecular formula C17H18ClF3N4O2 and a molecular weight of 402.80 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-7,7,7-trifluoro-3-oxoheptanamide.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-7,7,7-trifluoro-3-oxoheptanamide |
|---|---|
| PubChem CID | 118023098 |
| Molecular Formula | C17H18ClF3N4O2 |
| Molecular Weight | 402.80 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-7,7,7-trifluoro-3-oxoheptanamide |
| SMILES | CCN(C(=O)CC(=O)CCCC(F)(F)F)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C17H18ClF3N4O2/c1-2-24(15(27)9-13(26)6-3-7-17(19,20)21)14-11-25(23-16(14)18)12-5-4-8-22-10-12/h4-5,8,10-11H,2-3,6-7,9H2,1H3 |
| InChIKey | ACSSDPXRKKPNKC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|