C18H21ClF3N5O2S — CID 123852373
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-2-methylimino-3-(4,4,4-trifluorobutylsulfinyl)propanamide (PubChem CID 123852373) has the molecular formula C18H21ClF3N5O2S and a molecular weight of 463.91 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-2-methylimino-3-(4,4,4-trifluorobutylsulfinyl)propanamide.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-2-methylimino-3-(4,4,4-trifluorobutylsulfinyl)propanamide |
|---|---|
| PubChem CID | 123852373 |
| Molecular Formula | C18H21ClF3N5O2S |
| Molecular Weight | 463.91 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-2-methylimino-3-(4,4,4-trifluorobutylsulfinyl)propanamide |
| SMILES | CCN(C(=O)/C(CS(=O)CCCC(F)(F)F)=N/C)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C18H21ClF3N5O2S/c1-3-26(15-11-27(25-16(15)19)13-6-4-8-24-10-13)17(28)14(23-2)12-30(29)9-5-7-18(20,21)22/h4,6,8,10-11H,3,5,7,9,12H2,1-2H3/b23-14+ |
| InChIKey | WDEGBCYNMYIUAS-OEAKJJBVSA-N |
| XLogP | 3.44 |
| TPSA | 80.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.91 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|