C15H18ClN5O2S — CID 118021798
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-ethoxyimino-N-ethyl-3-sulfanylpropanamide (PubChem CID 118021798) has the molecular formula C15H18ClN5O2S and a molecular weight of 367.86 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-ethoxyimino-N-ethyl-3-sulfanylpropanamide.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-ethoxyimino-N-ethyl-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 118021798 |
| Molecular Formula | C15H18ClN5O2S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-ethoxyimino-N-ethyl-3-sulfanylpropanamide |
| SMILES | CCON=C(CS)C(=O)N(CC)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C15H18ClN5O2S/c1-3-20(15(22)12(10-24)19-23-4-2)13-9-21(18-14(13)16)11-6-5-7-17-8-11/h5-9,24H,3-4,10H2,1-2H3 |
| InChIKey | UWEQYAQJNGTIHQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|