C14H12ClF3N4O — CID 123277810
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-4,4,4-trifluorobut-2-enamide (PubChem CID 123277810) has the molecular formula C14H12ClF3N4O and a molecular weight of 344.72 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-4,4,4-trifluorobut-2-enamide.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-4,4,4-trifluorobut-2-enamide |
|---|---|
| PubChem CID | 123277810 |
| Molecular Formula | C14H12ClF3N4O |
| Molecular Weight | 344.72 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-4,4,4-trifluorobut-2-enamide |
| SMILES | CCN(C(=O)C=CC(F)(F)F)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C14H12ClF3N4O/c1-2-21(12(23)5-6-14(16,17)18)11-9-22(20-13(11)15)10-4-3-7-19-8-10/h3-9H,2H2,1H3 |
| InChIKey | BFGRVAWBOAHPAM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.72 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|