C17H19ClF3N5O2 — CID 118032679
(4E)-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-4-(2,2,2-trifluoroethoxyimino)pentanamide (PubChem CID 118032679) has the molecular formula C17H19ClF3N5O2 and a molecular weight of 417.82 g/mol. Its IUPAC name is (4E)-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-4-(2,2,2-trifluoroethoxyimino)pentanamide.
| Compound Name | (4E)-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-4-(2,2,2-trifluoroethoxyimino)pentanamide |
|---|---|
| PubChem CID | 118032679 |
| Molecular Formula | C17H19ClF3N5O2 |
| Molecular Weight | 417.82 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | (4E)-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethyl-4-(2,2,2-trifluoroethoxyimino)pentanamide |
| SMILES | CCN(C(=O)CC/C(C)=N/OCC(F)(F)F)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C17H19ClF3N5O2/c1-3-25(15(27)7-6-12(2)24-28-11-17(19,20)21)14-10-26(23-16(14)18)13-5-4-8-22-9-13/h4-5,8-10H,3,6-7,11H2,1-2H3/b24-12+ |
| InChIKey | IYZSMPCBCNEQDM-WYMPLXKRSA-N |
| XLogP | 4.01 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|