C22H28ClN7O3 — CID 118032695
(4E)-4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methoxyimino]-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethylpentanamide (PubChem CID 118032695) has the molecular formula C22H28ClN7O3 and a molecular weight of 473.97 g/mol. Its IUPAC name is (4E)-4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methoxyimino]-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethylpentanamide.
| Compound Name | (4E)-4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methoxyimino]-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethylpentanamide |
|---|---|
| PubChem CID | 118032695 |
| Molecular Formula | C22H28ClN7O3 |
| Molecular Weight | 473.97 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | (4E)-4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methoxyimino]-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-ethylpentanamide |
| SMILES | CCN(C(=O)CC/C(C)=N/OCc1noc(C(C)(C)C)n1)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C22H28ClN7O3/c1-6-29(17-13-30(26-20(17)23)16-8-7-11-24-12-16)19(31)10-9-15(2)27-32-14-18-25-21(33-28-18)22(3,4)5/h7-8,11-13H,6,9-10,14H2,1-5H3/b27-15+ |
| InChIKey | HCOBYZSKEZASIV-JFLMPSFJSA-N |
| XLogP | 4.33 |
| TPSA | 111.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.97 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|