C35H30ClN5O2S — CID 118021446
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-ethoxyimino-N-prop-2-ynyl-3-tritylsulfanylpropanamide (PubChem CID 118021446) has the molecular formula C35H30ClN5O2S and a molecular weight of 620.18 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-ethoxyimino-N-prop-2-ynyl-3-tritylsulfanylpropanamide.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-ethoxyimino-N-prop-2-ynyl-3-tritylsulfanylpropanamide |
|---|---|
| PubChem CID | 118021446 |
| Molecular Formula | C35H30ClN5O2S |
| Molecular Weight | 620.18 g/mol |
| Exact Mass | 619.18 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-ethoxyimino-N-prop-2-ynyl-3-tritylsulfanylpropanamide |
| SMILES | C#CCN(C(=O)C(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)=NOCC)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C35H30ClN5O2S/c1-3-23-40(32-25-41(38-33(32)36)30-21-14-22-37-24-30)34(42)31(39-43-4-2)26-44-35(27-15-8-5-9-16-27,28-17-10-6-11-18-28)29-19-12-7-13-20-29/h1,5-22,24-25H,4,23,26H2,2H3 |
| InChIKey | CLVUDVISMLKVKQ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.18 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|