C34H28ClN5O2S — CID 118021413
(2Z)-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methoxyimino-N-prop-2-ynyl-3-tritylsulfanylpropanamide (PubChem CID 118021413) has the molecular formula C34H28ClN5O2S and a molecular weight of 606.15 g/mol. Its IUPAC name is (2Z)-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methoxyimino-N-prop-2-ynyl-3-tritylsulfanylpropanamide.
| Compound Name | (2Z)-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methoxyimino-N-prop-2-ynyl-3-tritylsulfanylpropanamide |
|---|---|
| PubChem CID | 118021413 |
| Molecular Formula | C34H28ClN5O2S |
| Molecular Weight | 606.15 g/mol |
| Exact Mass | 605.17 |
| IUPAC Name | (2Z)-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methoxyimino-N-prop-2-ynyl-3-tritylsulfanylpropanamide |
| SMILES | C#CCN(C(=O)/C(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)=N/OC)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C34H28ClN5O2S/c1-3-22-39(31-24-40(37-32(31)35)29-20-13-21-36-23-29)33(41)30(38-42-2)25-43-34(26-14-7-4-8-15-26,27-16-9-5-10-17-27)28-18-11-6-12-19-28/h1,4-21,23-24H,22,25H2,2H3/b38-30+ |
| InChIKey | MOSSAMUZPKRKRV-BIXQXLNPSA-N |
| XLogP | 6.61 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.15 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|