C31H27ClN4OS — CID 86700562
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-methyl-3-tritylsulfanylpropanamide (PubChem CID 86700562) has the molecular formula C31H27ClN4OS and a molecular weight of 539.10 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-methyl-3-tritylsulfanylpropanamide.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-methyl-3-tritylsulfanylpropanamide |
|---|---|
| PubChem CID | 86700562 |
| Molecular Formula | C31H27ClN4OS |
| Molecular Weight | 539.10 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-N-methyl-3-tritylsulfanylpropanamide |
| SMILES | CN(C(=O)CCSC(c1ccccc1)(c1ccccc1)c1ccccc1)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C31H27ClN4OS/c1-35(28-23-36(34-30(28)32)27-18-11-20-33-22-27)29(37)19-21-38-31(24-12-5-2-6-13-24,25-14-7-3-8-15-25)26-16-9-4-10-17-26/h2-18,20,22-23H,19,21H2,1H3 |
| InChIKey | BZPCJCUVFHJMTM-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.10 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|