C37H38ClN5O2S — CID 144834911
(2Z)-N-[(E)-3-chloro-1-[methylamino(pyridin-3-yl)amino]but-1-en-2-yl]-2-ethoxyimino-N-prop-2-ynyl-3-tritylsulfanylpropanamide (PubChem CID 144834911) has the molecular formula C37H38ClN5O2S and a molecular weight of 652.26 g/mol. Its IUPAC name is (2Z)-N-[(E)-3-chloro-1-[methylamino(pyridin-3-yl)amino]but-1-en-2-yl]-2-ethoxyimino-N-prop-2-ynyl-3-tritylsulfanylpropanamide.
| Compound Name | (2Z)-N-[(E)-3-chloro-1-[methylamino(pyridin-3-yl)amino]but-1-en-2-yl]-2-ethoxyimino-N-prop-2-ynyl-3-tritylsulfanylpropanamide |
|---|---|
| PubChem CID | 144834911 |
| Molecular Formula | C37H38ClN5O2S |
| Molecular Weight | 652.26 g/mol |
| Exact Mass | 651.24 |
| IUPAC Name | (2Z)-N-[(E)-3-chloro-1-[methylamino(pyridin-3-yl)amino]but-1-en-2-yl]-2-ethoxyimino-N-prop-2-ynyl-3-tritylsulfanylpropanamide |
| SMILES | C#CCN(C(=O)/C(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)=N/OCC)/C(=C/N(NC)c1cccnc1)C(C)Cl |
| InChI | InChI=1S/C37H38ClN5O2S/c1-5-25-42(35(29(3)38)27-43(39-4)33-23-16-24-40-26-33)36(44)34(41-45-6-2)28-46-37(30-17-10-7-11-18-30,31-19-12-8-13-20-31)32-21-14-9-15-22-32/h1,7-24,26-27,29,39H,6,25,28H2,2-4H3/b35-27+,41-34+ |
| InChIKey | AOQNXFWEOCWSPU-IXYAFLIPSA-N |
| XLogP | 7.07 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.26 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|