C16H16ClN5O4S — CID 72947970
(2Z)-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methoxyimino-3-methylsulfonyl-N-prop-2-ynylpropanamide (PubChem CID 72947970) has the molecular formula C16H16ClN5O4S and a molecular weight of 409.86 g/mol. Its IUPAC name is (2Z)-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methoxyimino-3-methylsulfonyl-N-prop-2-ynylpropanamide.
| Compound Name | (2Z)-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methoxyimino-3-methylsulfonyl-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 72947970 |
| Molecular Formula | C16H16ClN5O4S |
| Molecular Weight | 409.86 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | (2Z)-N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methoxyimino-3-methylsulfonyl-N-prop-2-ynylpropanamide |
| SMILES | C#CCN(C(=O)/C(CS(C)(=O)=O)=N/OC)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C16H16ClN5O4S/c1-4-8-21(16(23)13(20-26-2)11-27(3,24)25)14-10-22(19-15(14)17)12-6-5-7-18-9-12/h1,5-7,9-10H,8,11H2,2-3H3/b20-13+ |
| InChIKey | WWLNPTDMTGMGRQ-DEDYPNTBSA-N |
| XLogP | 0.93 |
| TPSA | 106.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.86 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|