C19H24F3N5O2S — CID 123651903
N-ethyl-2-methoxyimino-N-(3-methyl-1-pyridin-3-ylpyrazol-4-yl)-3-(4,4,4-trifluorobutylsulfanyl)propanamide (PubChem CID 123651903) has the molecular formula C19H24F3N5O2S and a molecular weight of 443.50 g/mol. Its IUPAC name is N-ethyl-2-methoxyimino-N-(3-methyl-1-pyridin-3-ylpyrazol-4-yl)-3-(4,4,4-trifluorobutylsulfanyl)propanamide.
| Compound Name | N-ethyl-2-methoxyimino-N-(3-methyl-1-pyridin-3-ylpyrazol-4-yl)-3-(4,4,4-trifluorobutylsulfanyl)propanamide |
|---|---|
| PubChem CID | 123651903 |
| Molecular Formula | C19H24F3N5O2S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | N-ethyl-2-methoxyimino-N-(3-methyl-1-pyridin-3-ylpyrazol-4-yl)-3-(4,4,4-trifluorobutylsulfanyl)propanamide |
| SMILES | CCN(C(=O)C(CSCCCC(F)(F)F)=NOC)c1cn(-c2cccnc2)nc1C |
| InChI | InChI=1S/C19H24F3N5O2S/c1-4-26(17-12-27(24-14(17)2)15-7-5-9-23-11-15)18(28)16(25-29-3)13-30-10-6-8-19(20,21)22/h5,7,9,11-12H,4,6,8,10,13H2,1-3H3 |
| InChIKey | VJNJGVCRBYVZMG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|