C18H22F3N5O3S — CID 118027545
(2E)-N-ethyl-2-methoxyimino-N-(3-methyl-1-pyridin-3-ylpyrazol-4-yl)-3-(3,3,3-trifluoropropylsulfinyl)propanamide (PubChem CID 118027545) has the molecular formula C18H22F3N5O3S and a molecular weight of 445.47 g/mol. Its IUPAC name is (2E)-N-ethyl-2-methoxyimino-N-(3-methyl-1-pyridin-3-ylpyrazol-4-yl)-3-(3,3,3-trifluoropropylsulfinyl)propanamide.
| Compound Name | (2E)-N-ethyl-2-methoxyimino-N-(3-methyl-1-pyridin-3-ylpyrazol-4-yl)-3-(3,3,3-trifluoropropylsulfinyl)propanamide |
|---|---|
| PubChem CID | 118027545 |
| Molecular Formula | C18H22F3N5O3S |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (2E)-N-ethyl-2-methoxyimino-N-(3-methyl-1-pyridin-3-ylpyrazol-4-yl)-3-(3,3,3-trifluoropropylsulfinyl)propanamide |
| SMILES | CCN(C(=O)/C(CS(=O)CCC(F)(F)F)=N\OC)c1cn(-c2cccnc2)nc1C |
| InChI | InChI=1S/C18H22F3N5O3S/c1-4-25(16-11-26(23-13(16)2)14-6-5-8-22-10-14)17(27)15(24-29-3)12-30(28)9-7-18(19,20)21/h5-6,8,10-11H,4,7,9,12H2,1-3H3/b24-15- |
| InChIKey | DSLWRHYFJVCSQS-IWIPYMOSSA-N |
| XLogP | 2.63 |
| TPSA | 89.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|